C28H40BN4O2S — CID 154669632
CID 154669632 (PubChem CID 154669632) has the molecular formula C28H40BN4O2S and a molecular weight of 507.53 g/mol.
| Compound Name | CID 154669632 |
|---|---|
| PubChem CID | 154669632 |
| Molecular Formula | C28H40BN4O2S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | — |
| SMILES | CCCCCCC(C)CC.C[B]n1ccc(C(=O)NCC(=O)Nc2nc(-c3cccc(C)c3)cs2)c1 |
| InChI | InChI=1S/C18H18BN4O2S.C10H22/c1-12-4-3-5-13(8-12)15-11-26-18(21-15)22-16(24)9-20-17(25)14-6-7-23(10-14)19-2;1-4-6-7-8-9-10(3)5-2/h3-8,10-11H,9H2,1-2H3,(H,20,25)(H,21,22,24);10H,4-9H2,1-3H3 |
| InChIKey | YEXJDXOQDOGHNU-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|