C24H23BN5O3S — CID 154669490
CID 154669490 (PubChem CID 154669490) has the molecular formula C24H23BN5O3S and a molecular weight of 472.36 g/mol.
| Compound Name | CID 154669490 |
|---|---|
| PubChem CID | 154669490 |
| Molecular Formula | C24H23BN5O3S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | — |
| SMILES | C[B]n1ccc(C(=O)NC(COC)C(=O)Nc2nc(-c3cccc(-c4ccncc4)c3)cs2)c1 |
| InChI | InChI=1S/C24H23BN5O3S/c1-25-30-11-8-19(13-30)22(31)27-20(14-33-2)23(32)29-24-28-21(15-34-24)18-5-3-4-17(12-18)16-6-9-26-10-7-16/h3-13,15,20H,14H2,1-2H3,(H,27,31)(H,28,29,32) |
| InChIKey | PXCHWHKLZJXMQZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|