C26H29BN5O3S — CID 154669441
CID 154669441 (PubChem CID 154669441) has the molecular formula C26H29BN5O3S and a molecular weight of 502.43 g/mol.
| Compound Name | CID 154669441 |
|---|---|
| PubChem CID | 154669441 |
| Molecular Formula | C26H29BN5O3S |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | — |
| SMILES | C=C(/C=C\N=C\CC)c1cccc(-c2csc(NC(=O)C(COC)NC(=O)c3ccn([B]C)c3)n2)c1 |
| InChI | InChI=1S/C26H29BN5O3S/c1-5-11-28-12-9-18(2)19-7-6-8-20(14-19)23-17-36-26(30-23)31-25(34)22(16-35-4)29-24(33)21-10-13-32(15-21)27-3/h6-15,17,22H,2,5,16H2,1,3-4H3,(H,29,33)(H,30,31,34)/b12-9-,28-11+ |
| InChIKey | JEQZKNUPRRSMGX-UVJAWKRXSA-N |
| XLogP | 4.52 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|