C22H24BN4O4S — CID 154668096
CID 154668096 (PubChem CID 154668096) has the molecular formula C22H24BN4O4S and a molecular weight of 451.34 g/mol.
| Compound Name | CID 154668096 |
|---|---|
| PubChem CID | 154668096 |
| Molecular Formula | C22H24BN4O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | — |
| SMILES | C[B]n1ccc(C(=O)NC(COC)C(=O)Nc2nc(-c3cccc(C4COC4)c3)cs2)c1 |
| InChI | InChI=1S/C22H24BN4O4S/c1-23-27-7-6-16(9-27)20(28)24-18(12-30-2)21(29)26-22-25-19(13-32-22)15-5-3-4-14(8-15)17-10-31-11-17/h3-9,13,17-18H,10-12H2,1-2H3,(H,24,28)(H,25,26,29) |
| InChIKey | BTKYXVWIRBZDMH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|