C19H20BFN5O3S — CID 154667820
CID 154667820 (PubChem CID 154667820) has the molecular formula C19H20BFN5O3S and a molecular weight of 428.28 g/mol.
| Compound Name | CID 154667820 |
|---|---|
| PubChem CID | 154667820 |
| Molecular Formula | C19H20BFN5O3S |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | — |
| SMILES | C[B]n1ccc(C(=O)NC(COC)C(=O)Nc2nc(-c3ccc(F)c(C)n3)cs2)c1 |
| InChI | InChI=1S/C19H20BFN5O3S/c1-11-13(21)4-5-14(22-11)16-10-30-19(24-16)25-18(28)15(9-29-3)23-17(27)12-6-7-26(8-12)20-2/h4-8,10,15H,9H2,1-3H3,(H,23,27)(H,24,25,28) |
| InChIKey | JJLZVUVQTCPDAA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|