C24H23N6O4S+ — CID 154668536
[3-[[3-methoxy-1-oxo-1-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]propan-2-yl]carbamoyl]pyrrol-1-yl]-methyl-oxoazanium (PubChem CID 154668536) has the molecular formula C24H23N6O4S+ and a molecular weight of 491.55 g/mol. Its IUPAC name is [3-[[3-methoxy-1-oxo-1-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]propan-2-yl]carbamoyl]pyrrol-1-yl]-methyl-oxoazanium.
| Compound Name | [3-[[3-methoxy-1-oxo-1-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]propan-2-yl]carbamoyl]pyrrol-1-yl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 154668536 |
| Molecular Formula | C24H23N6O4S+ |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [3-[[3-methoxy-1-oxo-1-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]propan-2-yl]carbamoyl]pyrrol-1-yl]-methyl-oxoazanium |
| SMILES | COCC(NC(=O)c1ccn([N+](C)=O)c1)C(=O)Nc1nc(-c2cccc(-c3ccncc3)c2)cs1 |
| InChI | InChI=1S/C24H22N6O4S/c1-29(33)30-11-8-19(13-30)22(31)26-20(14-34-2)23(32)28-24-27-21(15-35-24)18-5-3-4-17(12-18)16-6-9-25-10-7-16/h3-13,15,20H,14H2,1-2H3,(H-,26,27,28,31,32)/p+1 |
| InChIKey | PXAGXFLRIWLVDQ-UHFFFAOYSA-O |
| XLogP | 3.23 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|