C18H20N2O3S — CID 2340359
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-cyclopentylacetate (PubChem CID 2340359) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-cyclopentylacetate.
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 2340359 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-cyclopentylacetate |
| SMILES | O=C(COC(=O)CC1CCCC1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H20N2O3S/c21-16(11-23-17(22)10-13-6-4-5-7-13)20-18-19-15(12-24-18)14-8-2-1-3-9-14/h1-3,8-9,12-13H,4-7,10-11H2,(H,19,20,21) |
| InChIKey | GNXFKPKLUUPHRU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |