C25H26N4O2S — CID 154668114
(Z,2E)-2-ethylidene-5-methyl-N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]hex-3-enamide (PubChem CID 154668114) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-5-methyl-N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]hex-3-enamide.
| Compound Name | (Z,2E)-2-ethylidene-5-methyl-N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]hex-3-enamide |
|---|---|
| PubChem CID | 154668114 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (Z,2E)-2-ethylidene-5-methyl-N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]hex-3-enamide |
| SMILES | C/C=C(\C=C/C(C)C)C(=O)NCC(=O)Nc1nc(-c2cccc(-c3ccncc3)c2)cs1 |
| InChI | InChI=1S/C25H26N4O2S/c1-4-18(9-8-17(2)3)24(31)27-15-23(30)29-25-28-22(16-32-25)21-7-5-6-20(14-21)19-10-12-26-13-11-19/h4-14,16-17H,15H2,1-3H3,(H,27,31)(H,28,29,30)/b9-8-,18-4+ |
| InChIKey | PLNBNNJCTJJTRC-XUDAGXLFSA-N |
| XLogP | 5.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|