C26H26N4O2SSi — CID 166521641
N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-3-trimethylsilylbenzamide (PubChem CID 166521641) has the molecular formula C26H26N4O2SSi and a molecular weight of 486.67 g/mol. Its IUPAC name is N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-3-trimethylsilylbenzamide.
| Compound Name | N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-3-trimethylsilylbenzamide |
|---|---|
| PubChem CID | 166521641 |
| Molecular Formula | C26H26N4O2SSi |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-3-trimethylsilylbenzamide |
| SMILES | C[Si](C)(C)c1cccc(C(=O)NCC(=O)Nc2nc(-c3cccc(-c4ccncc4)c3)cs2)c1 |
| InChI | InChI=1S/C26H26N4O2SSi/c1-34(2,3)22-9-5-8-21(15-22)25(32)28-16-24(31)30-26-29-23(17-33-26)20-7-4-6-19(14-20)18-10-12-27-13-11-18/h4-15,17H,16H2,1-3H3,(H,28,32)(H,29,30,31) |
| InChIKey | ATFUECAIKWSYOG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|