C25H22N6O2S — CID 139386797
N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-5,6,7,8-tetrahydro-1,8-naphthyridine-3-carboxamide (PubChem CID 139386797) has the molecular formula C25H22N6O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-5,6,7,8-tetrahydro-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-5,6,7,8-tetrahydro-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 139386797 |
| Molecular Formula | C25H22N6O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]-5,6,7,8-tetrahydro-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(CNC(=O)c1cnc2c(c1)CCCN2)Nc1nc(-c2cccc(-c3ccncc3)c2)cs1 |
| InChI | InChI=1S/C25H22N6O2S/c32-22(14-29-24(33)20-12-19-5-2-8-27-23(19)28-13-20)31-25-30-21(15-34-25)18-4-1-3-17(11-18)16-6-9-26-10-7-16/h1,3-4,6-7,9-13,15H,2,5,8,14H2,(H,27,28)(H,29,33)(H,30,31,32) |
| InChIKey | RBOZFEPINPAQGE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |