C28H29N7O2S — CID 155792349
4-amino-N-[2-[[4-[3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]benzamide (PubChem CID 155792349) has the molecular formula C28H29N7O2S and a molecular weight of 527.65 g/mol. Its IUPAC name is 4-amino-N-[2-[[4-[3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | 4-amino-N-[2-[[4-[3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 155792349 |
| Molecular Formula | C28H29N7O2S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 4-amino-N-[2-[[4-[3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]benzamide |
| SMILES | CN1CCN(c2cc(-c3cccc(-c4csc(NC(=O)CNC(=O)c5ccc(N)cc5)n4)c3)ccn2)CC1 |
| InChI | InChI=1S/C28H29N7O2S/c1-34-11-13-35(14-12-34)25-16-21(9-10-30-25)20-3-2-4-22(15-20)24-18-38-28(32-24)33-26(36)17-31-27(37)19-5-7-23(29)8-6-19/h2-10,15-16,18H,11-14,17,29H2,1H3,(H,31,37)(H,32,33,36) |
| InChIKey | GFIWRDHJMPZYGH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|