C23H22N4O2S — CID 154668432
(Z,2E)-2-ethylidene-N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]pent-3-enamide (PubChem CID 154668432) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]pent-3-enamide.
| Compound Name | (Z,2E)-2-ethylidene-N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]pent-3-enamide |
|---|---|
| PubChem CID | 154668432 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (Z,2E)-2-ethylidene-N-[2-oxo-2-[[4-(3-pyridin-4-ylphenyl)-1,3-thiazol-2-yl]amino]ethyl]pent-3-enamide |
| SMILES | C/C=C\C(=C/C)C(=O)NCC(=O)Nc1nc(-c2cccc(-c3ccncc3)c2)cs1 |
| InChI | InChI=1S/C23H22N4O2S/c1-3-6-16(4-2)22(29)25-14-21(28)27-23-26-20(15-30-23)19-8-5-7-18(13-19)17-9-11-24-12-10-17/h3-13,15H,14H2,1-2H3,(H,25,29)(H,26,27,28)/b6-3-,16-4+ |
| InChIKey | YNRWZDIWFIAMOC-QHVHUPHTSA-N |
| XLogP | 4.45 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|