C26H29N3O5S2 — CID 154668167
1-(cyclopropylidene-methyl-oxo-λ6-sulfanyl)-N-[2-oxo-3-[4-[3-[[(3R)-oxolan-3-yl]methoxy]phenyl]-1,3-thiazol-2-yl]propyl]pyrrole-3-carboxamide (PubChem CID 154668167) has the molecular formula C26H29N3O5S2 and a molecular weight of 527.67 g/mol. Its IUPAC name is 1-(cyclopropylidene-methyl-oxo-λ6-sulfanyl)-N-[2-oxo-3-[4-[3-[[(3R)-oxolan-3-yl]methoxy]phenyl]-1,3-thiazol-2-yl]propyl]pyrrole-3-carboxamide.
| Compound Name | 1-(cyclopropylidene-methyl-oxo-λ6-sulfanyl)-N-[2-oxo-3-[4-[3-[[(3R)-oxolan-3-yl]methoxy]phenyl]-1,3-thiazol-2-yl]propyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 154668167 |
| Molecular Formula | C26H29N3O5S2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 1-(cyclopropylidene-methyl-oxo-λ6-sulfanyl)-N-[2-oxo-3-[4-[3-[[(3R)-oxolan-3-yl]methoxy]phenyl]-1,3-thiazol-2-yl]propyl]pyrrole-3-carboxamide |
| SMILES | CS(=O)(=C1CC1)n1ccc(C(=O)NCC(=O)Cc2nc(-c3cccc(OC[C@@H]4CCOC4)c3)cs2)c1 |
| InChI | InChI=1S/C26H29N3O5S2/c1-36(32,23-5-6-23)29-9-7-20(14-29)26(31)27-13-21(30)12-25-28-24(17-35-25)19-3-2-4-22(11-19)34-16-18-8-10-33-15-18/h2-4,7,9,11,14,17-18H,5-6,8,10,12-13,15-16H2,1H3,(H,27,31)/t18-,36?/m1/s1 |
| InChIKey | RAYOASVDHIKYOK-CUQPBNISSA-N |
| XLogP | 3.21 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|