C16H19N3O3S — CID 154668811
2-amino-N-[4-[3-(oxolan-3-ylmethoxy)phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 154668811) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-amino-N-[4-[3-(oxolan-3-ylmethoxy)phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-amino-N-[4-[3-(oxolan-3-ylmethoxy)phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 154668811 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-amino-N-[4-[3-(oxolan-3-ylmethoxy)phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | NCC(=O)Nc1nc(-c2cccc(OCC3CCOC3)c2)cs1 |
| InChI | InChI=1S/C16H19N3O3S/c17-7-15(20)19-16-18-14(10-23-16)12-2-1-3-13(6-12)22-9-11-4-5-21-8-11/h1-3,6,10-11H,4-5,7-9,17H2,(H,18,19,20) |
| InChIKey | CQUJRAKOZISNKO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |