C16H20N4OS2 — CID 154668523
2-amino-N-[4-[3-(4-sulfanylpiperidin-1-yl)phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 154668523) has the molecular formula C16H20N4OS2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 2-amino-N-[4-[3-(4-sulfanylpiperidin-1-yl)phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-amino-N-[4-[3-(4-sulfanylpiperidin-1-yl)phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 154668523 |
| Molecular Formula | C16H20N4OS2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-amino-N-[4-[3-(4-sulfanylpiperidin-1-yl)phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | NCC(=O)Nc1nc(-c2cccc(N3CCC(S)CC3)c2)cs1 |
| InChI | InChI=1S/C16H20N4OS2/c17-9-15(21)19-16-18-14(10-23-16)11-2-1-3-12(8-11)20-6-4-13(22)5-7-20/h1-3,8,10,13,22H,4-7,9,17H2,(H,18,19,21) |
| InChIKey | LZEMWHNCBNKATB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|