C16H31F2N3 — CID 154670515
1-[2-(1-ethyl-2,2-difluoropiperidin-4-yl)ethyl]-4-propylpiperazine (PubChem CID 154670515) has the molecular formula C16H31F2N3 and a molecular weight of 303.44 g/mol. Its IUPAC name is 1-[2-(1-ethyl-2,2-difluoropiperidin-4-yl)ethyl]-4-propylpiperazine.
| Compound Name | 1-[2-(1-ethyl-2,2-difluoropiperidin-4-yl)ethyl]-4-propylpiperazine |
|---|---|
| PubChem CID | 154670515 |
| Molecular Formula | C16H31F2N3 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.25 |
| IUPAC Name | 1-[2-(1-ethyl-2,2-difluoropiperidin-4-yl)ethyl]-4-propylpiperazine |
| SMILES | CCCN1CCN(CCC2CCN(CC)C(F)(F)C2)CC1 |
| InChI | InChI=1S/C16H31F2N3/c1-3-7-19-10-12-20(13-11-19)8-5-15-6-9-21(4-2)16(17,18)14-15/h15H,3-14H2,1-2H3 |
| InChIKey | OKHAUNUPVDUVTF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|