C36H55N5O4 — CID 154677379
(2S)-2-cyclohexyl-N-[4-[3-oxo-2-(propanoylamino)-3-[(3S)-3-prop-1-en-2-ylpiperazin-1-yl]propyl]phenyl]propanamide;(E)-5-ethylimino-3-methylpent-3-en-2-one (PubChem CID 154677379) has the molecular formula C36H55N5O4 and a molecular weight of 621.87 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-N-[4-[3-oxo-2-(propanoylamino)-3-[(3S)-3-prop-1-en-2-ylpiperazin-1-yl]propyl]phenyl]propanamide;(E)-5-ethylimino-3-methylpent-3-en-2-one.
| Compound Name | (2S)-2-cyclohexyl-N-[4-[3-oxo-2-(propanoylamino)-3-[(3S)-3-prop-1-en-2-ylpiperazin-1-yl]propyl]phenyl]propanamide;(E)-5-ethylimino-3-methylpent-3-en-2-one |
|---|---|
| PubChem CID | 154677379 |
| Molecular Formula | C36H55N5O4 |
| Molecular Weight | 621.87 g/mol |
| Exact Mass | 621.43 |
| IUPAC Name | (2S)-2-cyclohexyl-N-[4-[3-oxo-2-(propanoylamino)-3-[(3S)-3-prop-1-en-2-ylpiperazin-1-yl]propyl]phenyl]propanamide;(E)-5-ethylimino-3-methylpent-3-en-2-one |
| SMILES | C=C(C)[C@H]1CN(C(=O)C(Cc2ccc(NC(=O)[C@@H](C)C3CCCCC3)cc2)NC(=O)CC)CCN1.CC/N=C/C=C(\C)C(C)=O |
| InChI | InChI=1S/C28H42N4O3.C8H13NO/c1-5-26(33)31-24(28(35)32-16-15-29-25(18-32)19(2)3)17-21-11-13-23(14-12-21)30-27(34)20(4)22-9-7-6-8-10-22;1-4-9-6-5-7(2)8(3)10/h11-14,20,22,24-25,29H,2,5-10,15-18H2,1,3-4H3,(H,30,34)(H,31,33);5-6H,4H2,1-3H3/b;7-5+,9-6+/t20-,24?,25+;/m0./s1 |
| InChIKey | OOUWOQWRFAKYLL-QTIUWRADSA-N |
| XLogP | 5.27 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.87 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|