C38H60N4O4 — CID 154677430
(2S)-2-cyclohexyl-N-[4-[3-(4-methyl-3-propylpiperazin-1-yl)-3-oxo-2-(propanoylamino)propyl]phenyl]propanamide;(3E)-3-propan-2-ylhexa-3,5-dien-2-one (PubChem CID 154677430) has the molecular formula C38H60N4O4 and a molecular weight of 636.92 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-N-[4-[3-(4-methyl-3-propylpiperazin-1-yl)-3-oxo-2-(propanoylamino)propyl]phenyl]propanamide;(3E)-3-propan-2-ylhexa-3,5-dien-2-one.
| Compound Name | (2S)-2-cyclohexyl-N-[4-[3-(4-methyl-3-propylpiperazin-1-yl)-3-oxo-2-(propanoylamino)propyl]phenyl]propanamide;(3E)-3-propan-2-ylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 154677430 |
| Molecular Formula | C38H60N4O4 |
| Molecular Weight | 636.92 g/mol |
| Exact Mass | 636.46 |
| IUPAC Name | (2S)-2-cyclohexyl-N-[4-[3-(4-methyl-3-propylpiperazin-1-yl)-3-oxo-2-(propanoylamino)propyl]phenyl]propanamide;(3E)-3-propan-2-ylhexa-3,5-dien-2-one |
| SMILES | C=C/C=C(/C(C)=O)C(C)C.CCCC1CN(C(=O)C(Cc2ccc(NC(=O)[C@@H](C)C3CCCCC3)cc2)NC(=O)CC)CCN1C |
| InChI | InChI=1S/C29H46N4O3.C9H14O/c1-5-10-25-20-33(18-17-32(25)4)29(36)26(31-27(34)6-2)19-22-13-15-24(16-14-22)30-28(35)21(3)23-11-8-7-9-12-23;1-5-6-9(7(2)3)8(4)10/h13-16,21,23,25-26H,5-12,17-20H2,1-4H3,(H,30,35)(H,31,34);5-7H,1H2,2-4H3/b;9-6+/t21-,25?,26?;/m0./s1 |
| InChIKey | HCFGLOCKQUKWTN-PDNLKFQCSA-N |
| XLogP | 6.57 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.92 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|