C20H25ClF2N4O — CID 154677915
(3E)-3-[6-chloro-8-fluoro-4-(4-methylpiperazin-1-yl)quinazolin-7-yl]-4-fluoropenta-1,3-dien-2-ol;ethane (PubChem CID 154677915) has the molecular formula C20H25ClF2N4O and a molecular weight of 410.90 g/mol. Its IUPAC name is (3E)-3-[6-chloro-8-fluoro-4-(4-methylpiperazin-1-yl)quinazolin-7-yl]-4-fluoropenta-1,3-dien-2-ol;ethane.
| Compound Name | (3E)-3-[6-chloro-8-fluoro-4-(4-methylpiperazin-1-yl)quinazolin-7-yl]-4-fluoropenta-1,3-dien-2-ol;ethane |
|---|---|
| PubChem CID | 154677915 |
| Molecular Formula | C20H25ClF2N4O |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (3E)-3-[6-chloro-8-fluoro-4-(4-methylpiperazin-1-yl)quinazolin-7-yl]-4-fluoropenta-1,3-dien-2-ol;ethane |
| SMILES | C=C(O)/C(=C(\C)F)c1c(Cl)cc2c(N3CCN(C)CC3)ncnc2c1F.CC |
| InChI | InChI=1S/C18H19ClF2N4O.C2H6/c1-10(20)14(11(2)26)15-13(19)8-12-17(16(15)21)22-9-23-18(12)25-6-4-24(3)5-7-25;1-2/h8-9,26H,2,4-7H2,1,3H3;1-2H3/b14-10-; |
| InChIKey | AXYGEIOXGTVUSS-DZOOLQPHSA-N |
| XLogP | 4.97 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|