C12H11BrClFN4 — CID 123902748
7-bromo-6-chloro-8-fluoro-4-piperazin-1-ylquinazoline (PubChem CID 123902748) has the molecular formula C12H11BrClFN4 and a molecular weight of 345.60 g/mol. Its IUPAC name is 7-bromo-6-chloro-8-fluoro-4-piperazin-1-ylquinazoline.
| Compound Name | 7-bromo-6-chloro-8-fluoro-4-piperazin-1-ylquinazoline |
|---|---|
| PubChem CID | 123902748 |
| Molecular Formula | C12H11BrClFN4 |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 7-bromo-6-chloro-8-fluoro-4-piperazin-1-ylquinazoline |
| SMILES | Fc1c(Br)c(Cl)cc2c(N3CCNCC3)ncnc12 |
| InChI | InChI=1S/C12H11BrClFN4/c13-9-8(14)5-7-11(10(9)15)17-6-18-12(7)19-3-1-16-2-4-19/h5-6,16H,1-4H2 |
| InChIKey | ODTNPOBOOKWVLT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|