C19H18ClF3N6 — CID 146624860
6-(6-chloro-4-piperazin-1-ylquinazolin-7-yl)-N-methyl-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 146624860) has the molecular formula C19H18ClF3N6 and a molecular weight of 422.84 g/mol. Its IUPAC name is 6-(6-chloro-4-piperazin-1-ylquinazolin-7-yl)-N-methyl-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(6-chloro-4-piperazin-1-ylquinazolin-7-yl)-N-methyl-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 146624860 |
| Molecular Formula | C19H18ClF3N6 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 6-(6-chloro-4-piperazin-1-ylquinazolin-7-yl)-N-methyl-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CNc1ccc(C(F)(F)F)c(-c2cc3ncnc(N4CCNCC4)c3cc2Cl)n1 |
| InChI | InChI=1S/C19H18ClF3N6/c1-24-16-3-2-13(19(21,22)23)17(28-16)11-9-15-12(8-14(11)20)18(27-10-26-15)29-6-4-25-5-7-29/h2-3,8-10,25H,4-7H2,1H3,(H,24,28) |
| InChIKey | RGDKEXHUGWZGIF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |