C22H19ClFN5 — CID 158860748
1-(6-chloro-4-piperidin-1-ylquinazolin-7-yl)-8-fluoroisoquinolin-3-amine (PubChem CID 158860748) has the molecular formula C22H19ClFN5 and a molecular weight of 407.88 g/mol. Its IUPAC name is 1-(6-chloro-4-piperidin-1-ylquinazolin-7-yl)-8-fluoroisoquinolin-3-amine.
| Compound Name | 1-(6-chloro-4-piperidin-1-ylquinazolin-7-yl)-8-fluoroisoquinolin-3-amine |
|---|---|
| PubChem CID | 158860748 |
| Molecular Formula | C22H19ClFN5 |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(6-chloro-4-piperidin-1-ylquinazolin-7-yl)-8-fluoroisoquinolin-3-amine |
| SMILES | Nc1cc2cccc(F)c2c(-c2cc3ncnc(N4CCCCC4)c3cc2Cl)n1 |
| InChI | InChI=1S/C22H19ClFN5/c23-16-10-15-18(26-12-27-22(15)29-7-2-1-3-8-29)11-14(16)21-20-13(9-19(25)28-21)5-4-6-17(20)24/h4-6,9-12H,1-3,7-8H2,(H2,25,28) |
| InChIKey | JAPURMLRWLVKCL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |