C19H18ClF2N5 — CID 158458481
6-(6-chloro-4-piperidin-1-ylquinazolin-7-yl)-5-(difluoromethyl)pyridin-2-amine (PubChem CID 158458481) has the molecular formula C19H18ClF2N5 and a molecular weight of 389.84 g/mol. Its IUPAC name is 6-(6-chloro-4-piperidin-1-ylquinazolin-7-yl)-5-(difluoromethyl)pyridin-2-amine.
| Compound Name | 6-(6-chloro-4-piperidin-1-ylquinazolin-7-yl)-5-(difluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 158458481 |
| Molecular Formula | C19H18ClF2N5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 6-(6-chloro-4-piperidin-1-ylquinazolin-7-yl)-5-(difluoromethyl)pyridin-2-amine |
| SMILES | Nc1ccc(C(F)F)c(-c2cc3ncnc(N4CCCCC4)c3cc2Cl)n1 |
| InChI | InChI=1S/C19H18ClF2N5/c20-14-8-13-15(24-10-25-19(13)27-6-2-1-3-7-27)9-12(14)17-11(18(21)22)4-5-16(23)26-17/h4-5,8-10,18H,1-3,6-7H2,(H2,23,26) |
| InChIKey | HEWCVESHFRFKSI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |