C34H33ClF2N4OSi — CID 178153097
tert-butyl-[2-(6-chloro-8-fluoro-4-piperazin-1-ylquinazolin-7-yl)-3-fluorophenoxy]-diphenylsilane (PubChem CID 178153097) has the molecular formula C34H33ClF2N4OSi and a molecular weight of 615.20 g/mol. Its IUPAC name is tert-butyl-[2-(6-chloro-8-fluoro-4-piperazin-1-ylquinazolin-7-yl)-3-fluorophenoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-(6-chloro-8-fluoro-4-piperazin-1-ylquinazolin-7-yl)-3-fluorophenoxy]-diphenylsilane |
|---|---|
| PubChem CID | 178153097 |
| Molecular Formula | C34H33ClF2N4OSi |
| Molecular Weight | 615.20 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | tert-butyl-[2-(6-chloro-8-fluoro-4-piperazin-1-ylquinazolin-7-yl)-3-fluorophenoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](Oc1cccc(F)c1-c1c(Cl)cc2c(N3CCNCC3)ncnc2c1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H33ClF2N4OSi/c1-34(2,3)43(23-11-6-4-7-12-23,24-13-8-5-9-14-24)42-28-16-10-15-27(36)30(28)29-26(35)21-25-32(31(29)37)39-22-40-33(25)41-19-17-38-18-20-41/h4-16,21-22,38H,17-20H2,1-3H3 |
| InChIKey | YYPSGLXAEOADEJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.20 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|