C22H38N4O3 — CID 154679408
aniline;3-(2-methoxyethoxy)propan-1-amine;4-N-(3-methoxypropyl)benzene-1,4-diamine (PubChem CID 154679408) has the molecular formula C22H38N4O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is aniline;3-(2-methoxyethoxy)propan-1-amine;4-N-(3-methoxypropyl)benzene-1,4-diamine.
| Compound Name | aniline;3-(2-methoxyethoxy)propan-1-amine;4-N-(3-methoxypropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 154679408 |
| Molecular Formula | C22H38N4O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | aniline;3-(2-methoxyethoxy)propan-1-amine;4-N-(3-methoxypropyl)benzene-1,4-diamine |
| SMILES | COCCCNc1ccc(N)cc1.COCCOCCCN.Nc1ccccc1 |
| InChI | InChI=1S/C10H16N2O.C6H15NO2.C6H7N/c1-13-8-2-7-12-10-5-3-9(11)4-6-10;1-8-5-6-9-4-2-3-7;7-6-4-2-1-3-5-6/h3-6,12H,2,7-8,11H2,1H3;2-7H2,1H3;1-5H,7H2 |
| InChIKey | DYSUYEZDLJWLOU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|