C18H25NO5 — CID 154682371
benzyl (2S,3S)-2-[(3-methoxy-3-oxopropanoyl)-methylamino]-3-methylpentanoate (PubChem CID 154682371) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is benzyl (2S,3S)-2-[(3-methoxy-3-oxopropanoyl)-methylamino]-3-methylpentanoate.
| Compound Name | benzyl (2S,3S)-2-[(3-methoxy-3-oxopropanoyl)-methylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 154682371 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | benzyl (2S,3S)-2-[(3-methoxy-3-oxopropanoyl)-methylamino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCc1ccccc1)N(C)C(=O)CC(=O)OC |
| InChI | InChI=1S/C18H25NO5/c1-5-13(2)17(19(3)15(20)11-16(21)23-4)18(22)24-12-14-9-7-6-8-10-14/h6-10,13,17H,5,11-12H2,1-4H3/t13-,17-/m0/s1 |
| InChIKey | HJKIQIIYNHOWHC-GUYCJALGSA-N |
| XLogP | 2.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|