C19H28FNO4 — CID 154682422
benzyl (2S,3S)-2-[ethyl-[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoate (PubChem CID 154682422) has the molecular formula C19H28FNO4 and a molecular weight of 353.43 g/mol. Its IUPAC name is benzyl (2S,3S)-2-[ethyl-[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoate.
| Compound Name | benzyl (2S,3S)-2-[ethyl-[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 154682422 |
| Molecular Formula | C19H28FNO4 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | benzyl (2S,3S)-2-[ethyl-[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCc1ccccc1)N(CC)C(=O)COCCF |
| InChI | InChI=1S/C19H28FNO4/c1-4-15(3)18(21(5-2)17(22)14-24-12-11-20)19(23)25-13-16-9-7-6-8-10-16/h6-10,15,18H,4-5,11-14H2,1-3H3/t15-,18-/m0/s1 |
| InChIKey | WOHMOAYNRPEGRV-YJBOKZPZSA-N |
| XLogP | 2.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|