C17H24N2O4 — CID 155059765
benzyl 2-[(3-amino-3-oxopropanoyl)-methylamino]-3-methylpentanoate (PubChem CID 155059765) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is benzyl 2-[(3-amino-3-oxopropanoyl)-methylamino]-3-methylpentanoate.
| Compound Name | benzyl 2-[(3-amino-3-oxopropanoyl)-methylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 155059765 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | benzyl 2-[(3-amino-3-oxopropanoyl)-methylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(C(=O)OCc1ccccc1)N(C)C(=O)CC(N)=O |
| InChI | InChI=1S/C17H24N2O4/c1-4-12(2)16(19(3)15(21)10-14(18)20)17(22)23-11-13-8-6-5-7-9-13/h5-9,12,16H,4,10-11H2,1-3H3,(H2,18,20) |
| InChIKey | OWHHSWINDDQYPQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|