C5H10N2S — CID 15468264
4-ethyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 15468264) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is 4-ethyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 15468264 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 4-ethyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC1CSC(N)=N1 |
| InChI | InChI=1S/C5H10N2S/c1-2-4-3-8-5(6)7-4/h4H,2-3H2,1H3,(H2,6,7) |
| InChIKey | SNCMUCDBGVDHSD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |