C4H8N2S — CID 568239
4-methyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 568239) has the molecular formula C4H8N2S and a molecular weight of 116.19 g/mol. Its IUPAC name is 4-methyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 568239 |
| Molecular Formula | C4H8N2S |
| Molecular Weight | 116.19 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | 4-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC1CSC(N)=N1 |
| InChI | InChI=1S/C4H8N2S/c1-3-2-7-4(5)6-3/h3H,2H2,1H3,(H2,5,6) |
| InChIKey | SILRNKZBMNSABG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |