C26H32N2O4 — CID 154683788
methyl 4-[[N-(cyclohexanecarbonyl)-3-(2-methoxy-4-pyridinyl)anilino]methyl]pent-4-enoate (PubChem CID 154683788) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is methyl 4-[[N-(cyclohexanecarbonyl)-3-(2-methoxy-4-pyridinyl)anilino]methyl]pent-4-enoate.
| Compound Name | methyl 4-[[N-(cyclohexanecarbonyl)-3-(2-methoxy-4-pyridinyl)anilino]methyl]pent-4-enoate |
|---|---|
| PubChem CID | 154683788 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | methyl 4-[[N-(cyclohexanecarbonyl)-3-(2-methoxy-4-pyridinyl)anilino]methyl]pent-4-enoate |
| SMILES | C=C(CCC(=O)OC)CN(C(=O)C1CCCCC1)c1cccc(-c2ccnc(OC)c2)c1 |
| InChI | InChI=1S/C26H32N2O4/c1-19(12-13-25(29)32-3)18-28(26(30)20-8-5-4-6-9-20)23-11-7-10-21(16-23)22-14-15-27-24(17-22)31-2/h7,10-11,14-17,20H,1,4-6,8-9,12-13,18H2,2-3H3 |
| InChIKey | KUVRSPFTGMJFPF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|