C13H33N3O — CID 154684230
ethane;4-(2-methoxyethyl)-2,5-dimethylpiperazin-1-amine (PubChem CID 154684230) has the molecular formula C13H33N3O and a molecular weight of 247.43 g/mol. Its IUPAC name is ethane;4-(2-methoxyethyl)-2,5-dimethylpiperazin-1-amine.
| Compound Name | ethane;4-(2-methoxyethyl)-2,5-dimethylpiperazin-1-amine |
|---|---|
| PubChem CID | 154684230 |
| Molecular Formula | C13H33N3O |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.26 |
| IUPAC Name | ethane;4-(2-methoxyethyl)-2,5-dimethylpiperazin-1-amine |
| SMILES | CC.CC.COCCN1CC(C)N(N)CC1C |
| InChI | InChI=1S/C9H21N3O.2C2H6/c1-8-7-12(10)9(2)6-11(8)4-5-13-3;2*1-2/h8-9H,4-7,10H2,1-3H3;2*1-2H3 |
| InChIKey | ODAGWNFFPFCQJF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|