C10H22N2OS — CID 154684370
1-(2-methoxyethyl)-2,5-dimethyl-4-methylsulfanylpiperazine (PubChem CID 154684370) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,5-dimethyl-4-methylsulfanylpiperazine.
| Compound Name | 1-(2-methoxyethyl)-2,5-dimethyl-4-methylsulfanylpiperazine |
|---|---|
| PubChem CID | 154684370 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-(2-methoxyethyl)-2,5-dimethyl-4-methylsulfanylpiperazine |
| SMILES | COCCN1CC(C)N(SC)CC1C |
| InChI | InChI=1S/C10H22N2OS/c1-9-8-12(14-4)10(2)7-11(9)5-6-13-3/h9-10H,5-8H2,1-4H3 |
| InChIKey | GZIHBDPTZPBLGB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|