C11H23NO — CID 126991337
1-(2-methoxyethyl)-2,6-dimethylazepane (PubChem CID 126991337) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,6-dimethylazepane.
| Compound Name | 1-(2-methoxyethyl)-2,6-dimethylazepane |
|---|---|
| PubChem CID | 126991337 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 1-(2-methoxyethyl)-2,6-dimethylazepane |
| SMILES | COCCN1CC(C)CCCC1C |
| InChI | InChI=1S/C11H23NO/c1-10-5-4-6-11(2)12(9-10)7-8-13-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | WFANDQPYTBEASC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |