C25H26N6O4 — CID 154684670
(2R,3S,4R,5S)-4-[2-[2-(1-benzofuran-2-yl)ethynyl]-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N,1,5-trimethylcyclopentane-1-carboxamide (PubChem CID 154684670) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is (2R,3S,4R,5S)-4-[2-[2-(1-benzofuran-2-yl)ethynyl]-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N,1,5-trimethylcyclopentane-1-carboxamide.
| Compound Name | (2R,3S,4R,5S)-4-[2-[2-(1-benzofuran-2-yl)ethynyl]-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N,1,5-trimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 154684670 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (2R,3S,4R,5S)-4-[2-[2-(1-benzofuran-2-yl)ethynyl]-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N,1,5-trimethylcyclopentane-1-carboxamide |
| SMILES | CNC(=O)C1(C)[C@H](C)[C@@H](n2cnc3c(NC)nc(C#Cc4cc5ccccc5o4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H26N6O4/c1-13-19(20(32)21(33)25(13,2)24(34)27-4)31-12-28-18-22(26-3)29-17(30-23(18)31)10-9-15-11-14-7-5-6-8-16(14)35-15/h5-8,11-13,19-21,32-33H,1-4H3,(H,27,34)(H,26,29,30)/t13-,19-,20+,21+,25?/m1/s1 |
| InChIKey | XYJZRXMYBDLJQN-RQWXBJIMSA-N |
| XLogP | 1.68 |
| TPSA | 138.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|