C24H26N6O4 — CID 134482755
(1R,2S,3R,4S,5R)-5-[6-(cyclobutylamino)-2-[2-(furan-2-yl)ethynyl]purin-9-yl]-3,4-dihydroxy-N-methylbicyclo[4.1.0]heptane-2-carboxamide (PubChem CID 134482755) has the molecular formula C24H26N6O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R)-5-[6-(cyclobutylamino)-2-[2-(furan-2-yl)ethynyl]purin-9-yl]-3,4-dihydroxy-N-methylbicyclo[4.1.0]heptane-2-carboxamide.
| Compound Name | (1R,2S,3R,4S,5R)-5-[6-(cyclobutylamino)-2-[2-(furan-2-yl)ethynyl]purin-9-yl]-3,4-dihydroxy-N-methylbicyclo[4.1.0]heptane-2-carboxamide |
|---|---|
| PubChem CID | 134482755 |
| Molecular Formula | C24H26N6O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (1R,2S,3R,4S,5R)-5-[6-(cyclobutylamino)-2-[2-(furan-2-yl)ethynyl]purin-9-yl]-3,4-dihydroxy-N-methylbicyclo[4.1.0]heptane-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H](O)[C@@H](O)[C@H](n2cnc3c(NC4CCC4)nc(C#Cc4ccco4)nc32)C2C[C@H]21 |
| InChI | InChI=1S/C24H26N6O4/c1-25-24(33)17-14-10-15(14)19(21(32)20(17)31)30-11-26-18-22(27-12-4-2-5-12)28-16(29-23(18)30)8-7-13-6-3-9-34-13/h3,6,9,11-12,14-15,17,19-21,31-32H,2,4-5,10H2,1H3,(H,25,33)(H,27,28,29)/t14-,15?,17+,19-,20-,21+/m1/s1 |
| InChIKey | VAPBOYIYXGBPRU-FTKXOCLWSA-N |
| XLogP | 1.06 |
| TPSA | 138.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|