C16H25N — CID 154686407
3-(3,4-dimethylphenyl)-1H-pyrrole;ethane (PubChem CID 154686407) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1H-pyrrole;ethane.
| Compound Name | 3-(3,4-dimethylphenyl)-1H-pyrrole;ethane |
|---|---|
| PubChem CID | 154686407 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1H-pyrrole;ethane |
| SMILES | CC.CC.Cc1ccc(-c2cc[nH]c2)cc1C |
| InChI | InChI=1S/C12H13N.2C2H6/c1-9-3-4-11(7-10(9)2)12-5-6-13-8-12;2*1-2/h3-8,13H,1-2H3;2*1-2H3 |
| InChIKey | YFZHYYBBDVROBR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |