C17H19Cl2N3O2S — CID 154687749
S-[2-[4-[2-[(3,5-dichlorobenzoyl)amino]propan-2-yl]pyrazol-1-yl]ethyl] ethanethioate (PubChem CID 154687749) has the molecular formula C17H19Cl2N3O2S and a molecular weight of 400.33 g/mol. Its IUPAC name is S-[2-[4-[2-[(3,5-dichlorobenzoyl)amino]propan-2-yl]pyrazol-1-yl]ethyl] ethanethioate.
| Compound Name | S-[2-[4-[2-[(3,5-dichlorobenzoyl)amino]propan-2-yl]pyrazol-1-yl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 154687749 |
| Molecular Formula | C17H19Cl2N3O2S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | S-[2-[4-[2-[(3,5-dichlorobenzoyl)amino]propan-2-yl]pyrazol-1-yl]ethyl] ethanethioate |
| SMILES | CC(=O)SCCn1cc(C(C)(C)NC(=O)c2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C17H19Cl2N3O2S/c1-11(23)25-5-4-22-10-13(9-20-22)17(2,3)21-16(24)12-6-14(18)8-15(19)7-12/h6-10H,4-5H2,1-3H3,(H,21,24) |
| InChIKey | ILQRPZJJBAGCFT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|