C20H25NO4 — CID 154689077
hexane-2,4-dione;1-[4-(4-methoxyphenyl)-2-methyl-1H-pyrrol-3-yl]ethanone (PubChem CID 154689077) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is hexane-2,4-dione;1-[4-(4-methoxyphenyl)-2-methyl-1H-pyrrol-3-yl]ethanone.
| Compound Name | hexane-2,4-dione;1-[4-(4-methoxyphenyl)-2-methyl-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 154689077 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | hexane-2,4-dione;1-[4-(4-methoxyphenyl)-2-methyl-1H-pyrrol-3-yl]ethanone |
| SMILES | CCC(=O)CC(C)=O.COc1ccc(-c2c[nH]c(C)c2C(C)=O)cc1 |
| InChI | InChI=1S/C14H15NO2.C6H10O2/c1-9-14(10(2)16)13(8-15-9)11-4-6-12(17-3)7-5-11;1-3-6(8)4-5(2)7/h4-8,15H,1-3H3;3-4H2,1-2H3 |
| InChIKey | XXDLVUYOCJVDMD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|