C9H13NO5S — CID 15469037
1-[5-[(1S,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-thiazol-2-yl]ethanone (PubChem CID 15469037) has the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. Its IUPAC name is 1-[5-[(1S,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-thiazol-2-yl]ethanone.
| Compound Name | 1-[5-[(1S,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 15469037 |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 1-[5-[(1S,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-thiazol-2-yl]ethanone |
| SMILES | CC(=O)c1ncc([C@@H](O)[C@@H](O)[C@H](O)CO)s1 |
| InChI | InChI=1S/C9H13NO5S/c1-4(12)9-10-2-6(16-9)8(15)7(14)5(13)3-11/h2,5,7-8,11,13-15H,3H2,1H3/t5-,7+,8-/m1/s1 |
| InChIKey | DDYLLKRDNVSZQV-MHSYXAOVSA-N |
| XLogP | -0.91 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |