5-butan-2-yl-1,3-thiazole-2-carboxylic acid

C8H11NO2S — CID 142861315

IUPAC5-butan-2-yl-1,3-thiazole-2-carboxylic acid
SMILESCCC(C)c1cnc(C(=O)O)s1
InChIInChI=1S/C8H11NO2S/c1-3-5(2)6-4-9-7(12-6)8(10)11/h4-5H,3H2,1-2H3,(H,10,11)
InChIKeyRHJLCNOHJVIATP-UHFFFAOYSA-N
MW185.25 g/mol
LogP2.35
Rot. Bonds3

About 5-butan-2-yl-1,3-thiazole-2-carboxylic acid

5-butan-2-yl-1,3-thiazole-2-carboxylic acid (PubChem CID 142861315) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 5-butan-2-yl-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name5-butan-2-yl-1,3-thiazole-2-carboxylic acid
PubChem CID142861315
Molecular FormulaC8H11NO2S
Molecular Weight185.25 g/mol
Exact Mass185.05
IUPAC Name5-butan-2-yl-1,3-thiazole-2-carboxylic acid
SMILESCCC(C)c1cnc(C(=O)O)s1
InChIInChI=1S/C8H11NO2S/c1-3-5(2)6-4-9-7(12-6)8(10)11/h4-5H,3H2,1-2H3,(H,10,11)
InChIKeyRHJLCNOHJVIATP-UHFFFAOYSA-N
XLogP2.35
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.25
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-butan-2-yl-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-butan-2-yl-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 5-butan-2-yl-1,3-thiazole-2-carboxylic acid (CID 142861315) is 5-butan-2-yl-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 5-butan-2-yl-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 5-butan-2-yl-1,3-thiazole-2-carboxylic acid is CCC(C)c1cnc(C(=O)O)s1.
What is the InChIKey of 5-butan-2-yl-1,3-thiazole-2-carboxylic acid?
The InChIKey is RHJLCNOHJVIATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-3-5(2)6-4-9-7(12-6)8(10)11/h4-5H,3H2,1-2H3,(H,10,11).
What are the key properties of 5-butan-2-yl-1,3-thiazole-2-carboxylic acid?
5-butan-2-yl-1,3-thiazole-2-carboxylic acid has a molecular weight of 185.25 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 142861315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).