C15H20NP — CID 154691312
3,3-dimethylbutylidene(1H-indol-6-ylmethyl)phosphane (PubChem CID 154691312) has the molecular formula C15H20NP and a molecular weight of 245.31 g/mol. Its IUPAC name is 3,3-dimethylbutylidene(1H-indol-6-ylmethyl)phosphane.
| Compound Name | 3,3-dimethylbutylidene(1H-indol-6-ylmethyl)phosphane |
|---|---|
| PubChem CID | 154691312 |
| Molecular Formula | C15H20NP |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 3,3-dimethylbutylidene(1H-indol-6-ylmethyl)phosphane |
| SMILES | CC(C)(C)C/C=P/Cc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C15H20NP/c1-15(2,3)7-9-17-11-12-4-5-13-6-8-16-14(13)10-12/h4-6,8-10,16H,7,11H2,1-3H3 |
| InChIKey | ISEULWZLPZVMBH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|