About N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane
N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane (PubChem CID 154694577) has the molecular formula C15H27F2N
and a molecular weight of 259.38 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane.
Molecular Properties
| Compound Name | N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane |
| PubChem CID | 154694577 |
| Molecular Formula | C15H27F2N |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane |
| SMILES | CC(C)C.CC1=CCC(NC2CC(F)(F)C2)CC1 |
| InChI | InChI=1S/C11H17F2N.C4H10/c1-8-2-4-9(5-3-8)14-10-6-11(12,13)7-10;1-4(2)3/h2,9-10,14H,3-7H2,1H3;4H,1-3H3 |
| InChIKey | QSEGXOCDAWMQFK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane?
The IUPAC name of N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane (CID 154694577) is N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane.
What is the SMILES notation for N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane?
The canonical SMILES for N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane is CC(C)C.CC1=CCC(NC2CC(F)(F)C2)CC1.
What is the InChIKey of N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane?
The InChIKey is QSEGXOCDAWMQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N.C4H10/c1-8-2-4-9(5-3-8)14-10-6-11(12,13)7-10;1-4(2)3/h2,9-10,14H,3-7H2,1H3;4H,1-3H3.
What are the key properties of N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane?
N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane has a molecular weight of 259.38 g/mol, XLogP of 4.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluorocyclobutyl)-4-methylcyclohex-3-en-1-amine;2-methylpropane is sourced from PubChem (CID 154694577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).