C21H30O2 — CID 154694626
(3S,7R,8R,10S,13S)-3-ethynyl-3-hydroxy-7,13-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 154694626) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3S,7R,8R,10S,13S)-3-ethynyl-3-hydroxy-7,13-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,7R,8R,10S,13S)-3-ethynyl-3-hydroxy-7,13-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 154694626 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (3S,7R,8R,10S,13S)-3-ethynyl-3-hydroxy-7,13-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C#C[C@]1(O)CC[C@H]2C(C[C@@H](C)[C@@H]3C2CC[C@]2(C)C(=O)CCC32)C1 |
| InChI | InChI=1S/C21H30O2/c1-4-21(23)10-8-15-14(12-21)11-13(2)19-16(15)7-9-20(3)17(19)5-6-18(20)22/h1,13-17,19,23H,5-12H2,2-3H3/t13-,14?,15+,16?,17?,19-,20+,21+/m1/s1 |
| InChIKey | QMDWCRFGYXCZML-RDDGILSLSA-N |
| XLogP | 3.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|