C30H18N2O4 — CID 154697323
6-(2-nitrophenyl)-12-phenyl-[1,4]benzodioxino[2,3-a]carbazole (PubChem CID 154697323) has the molecular formula C30H18N2O4 and a molecular weight of 470.48 g/mol. Its IUPAC name is 6-(2-nitrophenyl)-12-phenyl-[1,4]benzodioxino[2,3-a]carbazole.
| Compound Name | 6-(2-nitrophenyl)-12-phenyl-[1,4]benzodioxino[2,3-a]carbazole |
|---|---|
| PubChem CID | 154697323 |
| Molecular Formula | C30H18N2O4 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 6-(2-nitrophenyl)-12-phenyl-[1,4]benzodioxino[2,3-a]carbazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2c3ccccc3n(-c3ccccc3)c2c2c1Oc1ccccc1O2 |
| InChI | InChI=1S/C30H18N2O4/c33-32(34)25-15-7-5-13-21(25)23-18-22-20-12-4-6-14-24(20)31(19-10-2-1-3-11-19)28(22)30-29(23)35-26-16-8-9-17-27(26)36-30/h1-18H |
| InChIKey | YICUXGQCMCTVMA-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 66.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|