About (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine
(2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine (PubChem CID 154697500) has the molecular formula C12H18FN
and a molecular weight of 195.28 g/mol. Its IUPAC name is (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine.
Molecular Properties
| Compound Name | (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine |
| PubChem CID | 154697500 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine |
| SMILES | Cc1ccc(F)c([C@@H](C)[C@H](C)N)c1C |
| InChI | InChI=1S/C12H18FN/c1-7-5-6-11(13)12(8(7)2)9(3)10(4)14/h5-6,9-10H,14H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | HOAZMGWQFAYJGJ-UWVGGRQHSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine?
The IUPAC name of (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine (CID 154697500) is (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine.
What is the SMILES notation for (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine?
The canonical SMILES for (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine is Cc1ccc(F)c([C@@H](C)[C@H](C)N)c1C.
What is the InChIKey of (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine?
The InChIKey is HOAZMGWQFAYJGJ-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H18FN/c1-7-5-6-11(13)12(8(7)2)9(3)10(4)14/h5-6,9-10H,14H2,1-4H3/t9-,10-/m0/s1.
What are the key properties of (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine?
(2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine has a molecular weight of 195.28 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)butan-2-amine is sourced from PubChem (CID 154697500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).