C17H32O3Si — CID 154697544
[2-(2-ethenylcyclohexyl)-2-methylbut-3-enoxy]-ethyl-dimethoxysilane (PubChem CID 154697544) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is [2-(2-ethenylcyclohexyl)-2-methylbut-3-enoxy]-ethyl-dimethoxysilane.
| Compound Name | [2-(2-ethenylcyclohexyl)-2-methylbut-3-enoxy]-ethyl-dimethoxysilane |
|---|---|
| PubChem CID | 154697544 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | [2-(2-ethenylcyclohexyl)-2-methylbut-3-enoxy]-ethyl-dimethoxysilane |
| SMILES | C=CC1CCCCC1C(C)(C=C)CO[Si](CC)(OC)OC |
| InChI | InChI=1S/C17H32O3Si/c1-7-15-12-10-11-13-16(15)17(4,8-2)14-20-21(9-3,18-5)19-6/h7-8,15-16H,1-2,9-14H2,3-6H3 |
| InChIKey | SJCUPBPGWVLKDU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|