C20H38O3Si — CID 154697545
[3-(2-ethenylcyclohexyl)-3-methylpent-4-en-2-yl]oxy-diethoxy-ethylsilane (PubChem CID 154697545) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is [3-(2-ethenylcyclohexyl)-3-methylpent-4-en-2-yl]oxy-diethoxy-ethylsilane.
| Compound Name | [3-(2-ethenylcyclohexyl)-3-methylpent-4-en-2-yl]oxy-diethoxy-ethylsilane |
|---|---|
| PubChem CID | 154697545 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [3-(2-ethenylcyclohexyl)-3-methylpent-4-en-2-yl]oxy-diethoxy-ethylsilane |
| SMILES | C=CC1CCCCC1C(C)(C=C)C(C)O[Si](CC)(OCC)OCC |
| InChI | InChI=1S/C20H38O3Si/c1-8-18-15-13-14-16-19(18)20(7,9-2)17(6)23-24(12-5,21-10-3)22-11-4/h8-9,17-19H,1-2,10-16H2,3-7H3 |
| InChIKey | FPAYDUPHJWPVMW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|