C18H19ClN2O4 — CID 154698806
tert-butyl N-[3-(5-chloro-1,3-dioxoisoindol-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate (PubChem CID 154698806) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is tert-butyl N-[3-(5-chloro-1,3-dioxoisoindol-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-chloro-1,3-dioxoisoindol-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
|---|---|
| PubChem CID | 154698806 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | tert-butyl N-[3-(5-chloro-1,3-dioxoisoindol-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC12CC(N3C(=O)c4ccc(Cl)cc4C3=O)(C1)C2 |
| InChI | InChI=1S/C18H19ClN2O4/c1-16(2,3)25-15(24)20-17-7-18(8-17,9-17)21-13(22)11-5-4-10(19)6-12(11)14(21)23/h4-6H,7-9H2,1-3H3,(H,20,24) |
| InChIKey | MDDYDEOAROUKJD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|