C10H14N4O3S — CID 154700102
(5-butylpyrazolo[1,5-a]pyrimidin-7-yl)sulfamic acid (PubChem CID 154700102) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is (5-butylpyrazolo[1,5-a]pyrimidin-7-yl)sulfamic acid.
| Compound Name | (5-butylpyrazolo[1,5-a]pyrimidin-7-yl)sulfamic acid |
|---|---|
| PubChem CID | 154700102 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (5-butylpyrazolo[1,5-a]pyrimidin-7-yl)sulfamic acid |
| SMILES | CCCCc1cc(NS(=O)(=O)O)n2nccc2n1 |
| InChI | InChI=1S/C10H14N4O3S/c1-2-3-4-8-7-10(13-18(15,16)17)14-9(12-8)5-6-11-14/h5-7,13H,2-4H2,1H3,(H,15,16,17) |
| InChIKey | YCEGAALFECPYAS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|